ChemNet > CAS > 526-73-8 1,2,3-Trimethylbenzene
526-73-8 1,2,3-Trimethylbenzene
| उत्पाद का नाम |
1,2,3-Trimethylbenzene |
| अंग्रेजी नाम |
1,2,3-Trimethylbenzene; hemimellitene |
| आणविक फार्मूला |
C9H12 |
| आण्विक वजन |
120.19 |
| InChI |
InChI=1/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
| कैस रजिस्टी संख्या |
526-73-8 |
| EINECS |
208-394-8 |
| आणविक संरचना |
|
| घनत्व |
0.894 |
| गलनांक |
-25℃ |
| उबलने का समय |
175-176℃ |
| अपवर्तक सूचकांक |
1.513 |
| फ्लैश प्वाइंट |
53℃ |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R10:;
R37:;
|
| सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
