52721-69-4 2-Fluorophenethylamine
उत्पाद का नाम |
2-Fluorophenethylamine |
अंग्रेजी नाम |
2-Fluorophenethylamine; 2-(2-Fluorophenyl)-ethylamine; 2-(2-fluorophenyl)ethanamine; 2-(2-fluorophenyl)ethanaminium; 2-Fluoro-benzeneethanamine |
आणविक फार्मूला |
C8H11FN |
आण्विक वजन |
140.1775 |
InChI |
InChI=1/C8H10FN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5-6,10H2/p+1 |
कैस रजिस्टी संख्या |
52721-69-4 |
आणविक संरचना |
|
उबलने का समय |
242.8°C at 760 mmHg |
फ्लैश प्वाइंट |
77.2°C |
वाष्प का दबाव |
0.0333mmHg at 25°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|