ChemNet > CAS > 536-89-0 m-Tolylhydrazine
536-89-0 m-Tolylhydrazine
उत्पाद का नाम |
m-Tolylhydrazine |
अंग्रेजी नाम |
m-Tolylhydrazine; (3-methyl-phenyl)-hydrazine |
आणविक फार्मूला |
C7H10N2 |
आण्विक वजन |
122.16 |
InChI |
InChI=1/C7H10N2/c1-6-3-2-4-7(5-6)9-8/h2-5,9H,8H2,1H3 |
कैस रजिस्टी संख्या |
536-89-0 |
EINECS |
208-650-9 |
आणविक संरचना |
|
घनत्व |
1.057 |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|