ChemNet > CAS > 543-20-4 Succinyl chloride
543-20-4 Succinyl chloride
| उत्पाद का नाम |
Succinyl chloride |
| अंग्रेजी नाम |
Succinyl chloride; Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
| आणविक फार्मूला |
C4H4Cl2O2 |
| आण्विक वजन |
154.9794 |
| InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
| कैस रजिस्टी संख्या |
543-20-4 |
| EINECS |
208-838-0 |
| आणविक संरचना |
|
| घनत्व |
1.389g/cm3 |
| गलनांक |
16-17℃ |
| उबलने का समय |
193.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.456 |
| फ्लैश प्वाइंट |
76.7°C |
| वाष्प का दबाव |
0.466mmHg at 25°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
