543-20-4 Succinyl chloride
उत्पाद का नाम |
Succinyl chloride |
अंग्रेजी नाम |
Succinyl chloride; Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
आणविक फार्मूला |
C4H4Cl2O2 |
आण्विक वजन |
154.9794 |
InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
कैस रजिस्टी संख्या |
543-20-4 |
EINECS |
208-838-0 |
आणविक संरचना |
|
घनत्व |
1.389g/cm3 |
गलनांक |
16-17℃ |
उबलने का समय |
193.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.456 |
फ्लैश प्वाइंट |
76.7°C |
वाष्प का दबाव |
0.466mmHg at 25°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|