ChemNet > CAS > 5536-61-8 Sodium methacrylate
5536-61-8 Sodium methacrylate
| उत्पाद का नाम |
Sodium methacrylate |
| अंग्रेजी नाम |
Sodium methacrylate; Methacrylic acid sodium salt |
| आणविक फार्मूला |
C4H5NaO2 |
| आण्विक वजन |
108.07 |
| InChI |
InChI=1/C4H6O2.Na/c1-3(2)4(5)6;/h1H2,2H3,(H,5,6);/q;+1/p-1 |
| कैस रजिस्टी संख्या |
5536-61-8 |
| EINECS |
226-896-5 |
| आणविक संरचना |
|
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
