ChemNet > CAS > 55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
| उत्पाद का नाम |
2,6-Dimethoxy-3-nitrobenzoic acid |
| अंग्रेजी नाम |
2,6-Dimethoxy-3-nitrobenzoic acid; |
| आणविक फार्मूला |
C9H9NO6 |
| आण्विक वजन |
227.1709 |
| InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| कैस रजिस्टी संख्या |
55776-17-5 |
| EINECS |
259-814-1 |
| आणविक संरचना |
|
| घनत्व |
1.403g/cm3 |
| उबलने का समय |
420.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.569 |
| फ्लैश प्वाइंट |
208.2°C |
| वाष्प का दबाव |
7.92E-08mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
