ChemNet > CAS > 5653-62-3 2,3-Dimethoxybenzonitrile
5653-62-3 2,3-Dimethoxybenzonitrile
उत्पाद का नाम |
2,3-Dimethoxybenzonitrile |
अंग्रेजी नाम |
2,3-Dimethoxybenzonitrile;Benzonitrile, 2,3-dimethoxy-; 4-10-00-01418 (Beilstein Handbook Reference); BRN 2719631; NSC 27018; o-Veratronitrile (8CI) |
आणविक फार्मूला |
C9H9NO2 |
आण्विक वजन |
163.17 |
InChI |
InChI=1/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 |
कैस रजिस्टी संख्या |
5653-62-3 |
EINECS |
227-097-4 |
आणविक संरचना |
|
गलनांक |
41-46℃ |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|