ChemNet > CAS > 579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone
| उत्पाद का नाम |
(4-Fluorophenyl)-(2-thienyl) ketone |
| अंग्रेजी नाम |
(4-Fluorophenyl)-(2-thienyl) ketone; (4-Fluorophenyl)-2-thienyl methanone; 4-Fluorophenyl-2-thienyl ketone; (4-fluorophenyl)(thiophen-2-yl)methanone |
| आणविक फार्मूला |
C11H7FOS |
| आण्विक वजन |
206.2361 |
| InChI |
InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
| कैस रजिस्टी संख्या |
579-49-7 |
| EINECS |
209-442-0 |
| आणविक संरचना |
|
| घनत्व |
1.279g/cm3 |
| गलनांक |
94-99℃ |
| उबलने का समय |
314.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.59 |
| फ्लैश प्वाइंट |
144.1°C |
| वाष्प का दबाव |
0.000459mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
