ChemNet > CAS > 57915-78-3 2,3-dichlorobenzyl bromide
57915-78-3 2,3-dichlorobenzyl bromide
| उत्पाद का नाम |
2,3-dichlorobenzyl bromide |
| अंग्रेजी नाम |
2,3-dichlorobenzyl bromide;1-(bromomethyl)-2,3-dichlorobenzene |
| आणविक फार्मूला |
C7H5BrCl2 |
| आण्विक वजन |
239.9246 |
| InChI |
InChI=1/C7H5BrCl2/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 |
| कैस रजिस्टी संख्या |
57915-78-3 |
| आणविक संरचना |
|
| घनत्व |
1.679g/cm3 |
| गलनांक |
38℃ |
| उबलने का समय |
263.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.597 |
| फ्लैश प्वाइंट |
127.3°C |
| वाष्प का दबाव |
0.0169mmHg at 25°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
