ChemNet > CAS > 5866-98-8 2,6-Dichloro-3-nitrobenzonitrile
5866-98-8 2,6-Dichloro-3-nitrobenzonitrile
| उत्पाद का नाम |
2,6-Dichloro-3-nitrobenzonitrile |
| अंग्रेजी नाम |
2,6-Dichloro-3-nitrobenzonitrile; |
| आणविक फार्मूला |
C7H2Cl2N2O2 |
| आण्विक वजन |
217.009 |
| InChI |
InChI=1/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H |
| कैस रजिस्टी संख्या |
5866-98-8 |
| आणविक संरचना |
|
| घनत्व |
1.61g/cm3 |
| उबलने का समय |
341.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.615 |
| फ्लैश प्वाइंट |
160.5°C |
| वाष्प का दबाव |
7.9E-05mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
