ChemNet > CAS > 587-02-0 3-Ethylaniline
587-02-0 3-Ethylaniline
| उत्पाद का नाम |
3-Ethylaniline |
| अंग्रेजी नाम |
3-Ethylaniline;3-Ethylbenzenamine; 3-Ethylphenylamine; 4-12-00-02417 (Beilstein Handbook Reference); BRN 0636282; m-Ethylaniline; Aniline, m-ethyl-; Benzenamine, 3-ethyl- (9CI) |
| आणविक फार्मूला |
C8H11N |
| आण्विक वजन |
121.1796 |
| InChI |
InChI=1/C8H11N/c1-2-7-4-3-5-8(9)6-7/h3-6H,2,9H2,1H3 |
| कैस रजिस्टी संख्या |
587-02-0 |
| EINECS |
209-594-8 |
| आणविक संरचना |
|
| घनत्व |
0.973g/cm3 |
| गलनांक |
-8℃ |
| उबलने का समय |
216.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.556 |
| फ्लैश प्वाइंट |
85°C |
| वाष्प का दबाव |
0.139mmHg at 25°C |
| खतरा प्रतीक |
 T:Toxic;
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| सुरक्षा विवरण |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
