593-96-4 1-Bromo-1-chloroethane
उत्पाद का नाम |
1-Bromo-1-chloroethane |
अंग्रेजी नाम |
1-Bromo-1-chloroethane;Ethane, 1-bromo-1-chloro- |
आणविक फार्मूला |
C2H4BrCl |
आण्विक वजन |
143.4102 |
InChI |
InChI=1/C2H4BrCl/c1-2(3)4/h2H,1H3 |
कैस रजिस्टी संख्या |
593-96-4 |
EINECS |
209-820-5 |
आणविक संरचना |
|
घनत्व |
1.658g/cm3 |
उबलने का समय |
79.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.463 |
वाष्प का दबाव |
98.1mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|