ChemNet > CAS > 59463-56-8 सायनोमिथाइल ethanethioate
59463-56-8 सायनोमिथाइल ethanethioate
| उत्पाद का नाम |
सायनोमिथाइल ethanethioate |
| समानार्थी |
एस- (साइनोमिथाइल) एथेनथियोएट |
| अंग्रेजी नाम |
cyanomethyl ethanethioate;S-(cyanomethyl) ethanethioate |
| आणविक फार्मूला |
C4H5NOS |
| आण्विक वजन |
115.1536 |
| InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
| कैस रजिस्टी संख्या |
59463-56-8 |
| आणविक संरचना |
|
| घनत्व |
1.162g/cm3 |
| उबलने का समय |
198.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.487 |
| फ्लैश प्वाइंट |
73.6°C |
| वाष्प का दबाव |
0.367mmHg at 25°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
