ChemNet > CAS > 605-62-9 4-Nitro-1-Naphthol
605-62-9 4-Nitro-1-Naphthol
| उत्पाद का नाम |
4-Nitro-1-Naphthol |
| अंग्रेजी नाम |
4-Nitro-1-Naphthol; 4-nitronaphthalen-1-ol |
| आणविक फार्मूला |
C10H7NO3 |
| आण्विक वजन |
189.1675 |
| InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
| कैस रजिस्टी संख्या |
605-62-9 |
| आणविक संरचना |
|
| घनत्व |
1.413g/cm3 |
| उबलने का समय |
398.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.714 |
| फ्लैश प्वाइंट |
179.8°C |
| वाष्प का दबाव |
6.25E-07mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
