613-13-8 2-Aminoanthracene
उत्पाद का नाम |
2-Aminoanthracene |
अंग्रेजी नाम |
2-Aminoanthracene; 2-anthramine practical grade*crystalline; 2-anthrylamine; 2-Anthramine; 2-Anthranamine; anthracen-2-amine; 2-Anthracenamide;
|
आणविक फार्मूला |
C14H11N |
आण्विक वजन |
193.2438 |
InChI |
InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
कैस रजिस्टी संख्या |
613-13-8 |
EINECS |
210-330-9 |
आणविक संरचना |
|
घनत्व |
1.208g/cm3 |
गलनांक |
238-241℃ |
उबलने का समय |
414.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.765 |
फ्लैश प्वाइंट |
229°C |
वाष्प का दबाव |
4.52E-07mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R33:Danger of cummulative effects.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|