ChemNet > CAS > 620-88-2 4-Nitrophenyl phenyl ether
620-88-2 4-Nitrophenyl phenyl ether
| उत्पाद का नाम |
4-Nitrophenyl phenyl ether |
| अंग्रेजी नाम |
4-Nitrophenyl phenyl ether; p-Nitrodiphenyl ether; P-NITRODIPHENYLETHER; 1-nitro-4-phenoxybenzene; methyl 2-[(chloroacetyl)amino]benzoate; 2-chloro-N-(2-fluorophenyl)acetamide; 2-chloro-1-[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]ethanone |
| आणविक फार्मूला |
C15H16ClNO |
| आण्विक वजन |
261.7466 |
| InChI |
InChI=1/C15H16ClNO/c1-10-4-6-13(7-5-10)17-11(2)8-14(12(17)3)15(18)9-16/h4-8H,9H2,1-3H3 |
| कैस रजिस्टी संख्या |
620-88-2 |
| EINECS |
210-656-1 |
| आणविक संरचना |
|
| घनत्व |
1.12g/cm3 |
| गलनांक |
53-56℃ |
| उबलने का समय |
399.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.564 |
| फ्लैश प्वाइंट |
195.4°C |
| वाष्प का दबाव |
1.36E-06mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
