ChemNet > CAS > 6298-72-2 1,4-bis(chloromethyl)-2,5-dimethylbenzene
6298-72-2 1,4-bis(chloromethyl)-2,5-dimethylbenzene
उत्पाद का नाम |
1,4-bis(chloromethyl)-2,5-dimethylbenzene |
अंग्रेजी नाम |
1,4-bis(chloromethyl)-2,5-dimethylbenzene; 1,4-Bis(chloromethyl)-2,5-dimethylbenzene; 2,5-Di(Chloromethyl)-p-xylene; benzene, 1,4-bis(chloromethyl)-2,5-dimethyl- |
आणविक फार्मूला |
C10H12Cl2 |
आण्विक वजन |
203.1083 |
InChI |
InChI=1/C10H12Cl2/c1-7-3-10(6-12)8(2)4-9(7)5-11/h3-4H,5-6H2,1-2H3 |
कैस रजिस्टी संख्या |
6298-72-2 |
EINECS |
228-575-5 |
आणविक संरचना |
|
घनत्व |
1.145g/cm3 |
गलनांक |
131.5-132.5℃ |
उबलने का समय |
291.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.537 |
फ्लैश प्वाइंट |
142.2°C |
वाष्प का दबाव |
0.0034mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|