6304-16-1 (4-Pyridyl)acetone
उत्पाद का नाम |
(4-Pyridyl)acetone |
अंग्रेजी नाम |
(4-Pyridyl)acetone; 1-(4-Pyridyl)-2-propanone; 1-(pyridin-4-yl)propan-2-one; 1-(4-Pyridyl)-2-acetone; 1-(4-Pyridyl)acetone; 4-Pyridyl acetone |
आणविक फार्मूला |
C8H9NO |
आण्विक वजन |
135.1632 |
InChI |
InChI=1/C8H9NO/c1-7(10)6-8-2-4-9-5-3-8/h2-5H,6H2,1H3 |
कैस रजिस्टी संख्या |
6304-16-1 |
EINECS |
228-605-7 |
आणविक संरचना |
|
घनत्व |
1.047g/cm3 |
उबलने का समय |
232.523°C at 760 mmHg |
अपवर्तक सूचकांक |
1.509 |
फ्लैश प्वाइंट |
100.06°C |
वाष्प का दबाव |
0.059mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|