ChemNet > CAS > 6326-83-6 Bis(carboxymethyl) trithiocarbonate
6326-83-6 Bis(carboxymethyl) trithiocarbonate
| उत्पाद का नाम |
Bis(carboxymethyl) trithiocarbonate |
| अंग्रेजी नाम |
Bis(carboxymethyl) trithiocarbonate; 3,5-dithia-4-thioxo-1,7-heptanedioic acid; 2,2'-(carbonothioyldisulfanediyl)diacetic acid; 2,2'-(carbonothioyldisulfanediyl)diacetate |
| आणविक फार्मूला |
C5H4O4S3 |
| आण्विक वजन |
224.279 |
| InChI |
InChI=1/C5H6O4S3/c6-3(7)1-11-5(10)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)/p-2 |
| कैस रजिस्टी संख्या |
6326-83-6 |
| EINECS |
228-693-7 |
| आणविक संरचना |
|
| गलनांक |
170-175℃ |
| उबलने का समय |
532.5°C at 760 mmHg |
| फ्लैश प्वाइंट |
275.9°C |
| वाष्प का दबाव |
9.26E-13mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
