ChemNet > CAS > 67973-32-4 3,5-Dibromo-4-methylbenzoic acid
67973-32-4 3,5-Dibromo-4-methylbenzoic acid
उत्पाद का नाम |
3,5-Dibromo-4-methylbenzoic acid |
अंग्रेजी नाम |
3,5-Dibromo-4-methylbenzoic acid; 3,5-Dibromo-p-toluic acid (COOH=1); 3,5-Dibromo-p-toluic acid |
आणविक फार्मूला |
C8H6Br2O2 |
आण्विक वजन |
293.94 |
InChI |
InChI=1/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12) |
कैस रजिस्टी संख्या |
67973-32-4 |
आणविक संरचना |
|
घनत्व |
1.951g/cm3 |
उबलने का समय |
374.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.627 |
फ्लैश प्वाइंट |
180.3°C |
वाष्प का दबाव |
2.82E-06mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|