ChemNet > CAS > 6843-66-9 Diphenyldimethoxysilane
6843-66-9 Diphenyldimethoxysilane
| उत्पाद का नाम |
Diphenyldimethoxysilane |
| अंग्रेजी नाम |
Diphenyldimethoxysilane; Dimethoxydiphenylsilane; Diphenyl dimethoxylsilicane |
| आणविक फार्मूला |
C14H18O2Si |
| आण्विक वजन |
246.377 |
| InChI |
InChI=1/C12H10.C2H8O2Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;5H2,1-2H3 |
| कैस रजिस्टी संख्या |
6843-66-9 |
| EINECS |
229-929-1 |
| आणविक संरचना |
|
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R38:;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
