ChemNet > CAS > 6863-58-7 sec-Butyl ether (stabilized with HQ)
6863-58-7 sec-Butyl ether (stabilized with HQ)
उत्पाद का नाम |
sec-Butyl ether (stabilized with HQ) |
अंग्रेजी नाम |
sec-Butyl ether (stabilized with HQ);Butane, 2,2'-oxybis-; 0-01-00-00372 (Beilstein Handbook Reference); 2,2'-Oxybisbutane; BRN 1733014; Bis(2-butyl)ether; Di-sec-butyl ether; sec-Butyl ether |
आणविक फार्मूला |
C8H18O |
आण्विक वजन |
130.2279 |
InChI |
InChI=1S/C8H18O/c1-5-7(3)9-8(4)6-2/h7-8H,5-6H2,1-4H3 |
कैस रजिस्टी संख्या |
6863-58-7 |
EINECS |
229-961-6 |
आणविक संरचना |
|
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
|
|