69321-60-4 2,6-Dibromotoluene
उत्पाद का नाम |
2,6-Dibromotoluene |
अंग्रेजी नाम |
2,6-Dibromotoluene; 1,3-dibromo-2-methylbenzene |
आणविक फार्मूला |
C7H6Br2 |
आण्विक वजन |
249.9305 |
InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
कैस रजिस्टी संख्या |
69321-60-4 |
आणविक संरचना |
|
घनत्व |
1.81g/cm3 |
उबलने का समय |
246°C at 760 mmHg |
अपवर्तक सूचकांक |
1.587 |
फ्लैश प्वाइंट |
106.6°C |
वाष्प का दबाव |
0.0436mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|