ChemNet > CAS > 697-90-5 2,4-Dichloro-6-iodoaniline
697-90-5 2,4-Dichloro-6-iodoaniline
उत्पाद का नाम |
2,4-Dichloro-6-iodoaniline |
अंग्रेजी नाम |
2,4-Dichloro-6-iodoaniline; |
आणविक फार्मूला |
C6H4Cl2IN |
आण्विक वजन |
287.9131 |
InChI |
InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
कैस रजिस्टी संख्या |
697-90-5 |
आणविक संरचना |
|
घनत्व |
2.091g/cm3 |
उबलने का समय |
303.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.699 |
फ्लैश प्वाइंट |
137.5°C |
वाष्प का दबाव |
0.000911mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|