699-18-3 2-(2-nitrovinyl)furan
उत्पाद का नाम |
2-(2-nitrovinyl)furan |
अंग्रेजी नाम |
2-(2-nitrovinyl)furan; |
आणविक फार्मूला |
C6H5NO3 |
आण्विक वजन |
139.11 |
InChI |
InChI=1/C6H5NO3/c8-7(9)4-3-6-2-1-5-10-6/h1-5H/b4-3+ |
कैस रजिस्टी संख्या |
699-18-3 |
आणविक संरचना |
|
गलनांक |
72-75℃ |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|