ChemNet > CAS > 7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
उत्पाद का नाम |
1,3-dichloro-2-methyl-5-nitrobenzene |
अंग्रेजी नाम |
1,3-dichloro-2-methyl-5-nitrobenzene; 2,6-Dichloro-4-nitrotoluene |
आणविक फार्मूला |
C7H5Cl2NO2 |
आण्विक वजन |
206.0261 |
InChI |
InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
कैस रजिस्टी संख्या |
7149-69-1 |
आणविक संरचना |
|
घनत्व |
1.456g/cm3 |
गलनांक |
62℃ |
उबलने का समय |
279.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.585 |
फ्लैश प्वाइंट |
122.9°C |
वाष्प का दबाव |
0.00674mmHg at 25°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|