716-53-0 9-chloroanthracene
उत्पाद का नाम |
9-chloroanthracene |
अंग्रेजी नाम |
9-chloroanthracene;Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
आणविक फार्मूला |
C14H9Cl |
आण्विक वजन |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
कैस रजिस्टी संख्या |
716-53-0 |
EINECS |
211-937-1 |
आणविक संरचना |
|
घनत्व |
1.253g/cm3 |
गलनांक |
103-103℃ |
उबलने का समय |
370.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.717 |
फ्लैश प्वाइंट |
179.2°C |
वाष्प का दबाव |
2.42E-05mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|