ChemNet > CAS > 71902-33-5 3,5-Difluoropyridine
71902-33-5 3,5-Difluoropyridine
| उत्पाद का नाम |
3,5-Difluoropyridine |
| अंग्रेजी नाम |
3,5-Difluoropyridine; |
| आणविक फार्मूला |
C5H3F2N |
| आण्विक वजन |
115.0808 |
| InChI |
InChI=1/C5H3F2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| कैस रजिस्टी संख्या |
71902-33-5 |
| आणविक संरचना |
|
| घनत्व |
1.263g/cm3 |
| उबलने का समय |
79.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.446 |
| फ्लैश प्वाइंट |
1.9°C |
| वाष्प का दबाव |
98.5mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
