ChemNet > CAS > 7197-96-8 2,3-cycloheptenopyridine
7197-96-8 2,3-cycloheptenopyridine
| उत्पाद का नाम |
2,3-cycloheptenopyridine |
| अंग्रेजी नाम |
2,3-cycloheptenopyridine; |
| आणविक फार्मूला |
C10H13N |
| आण्विक वजन |
147.2169 |
| InChI |
InChI=1/C10H13N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h4,6,8H,1-3,5,7H2 |
| कैस रजिस्टी संख्या |
7197-96-8 |
| EINECS |
230-568-7 |
| आणविक संरचना |
|
| घनत्व |
0.999g/cm3 |
| उबलने का समय |
224.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.533 |
| फ्लैश प्वाइंट |
93.3°C |
| वाष्प का दबाव |
0.133mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
