ChemNet > CAS > 72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
उत्पाद का नाम |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
अंग्रेजी नाम |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
आणविक फार्मूला |
C14H8Cl4 |
आण्विक वजन |
318.02 |
InChI |
InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
कैस रजिस्टी संख्या |
72-55-9 |
EINECS |
200-784-6 |
आणविक संरचना |
|
गलनांक |
87-90℃ |
पानी की विलेयता |
0.00000013 g/100 mL |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R22:Harmful if swallowed.;
R33:Danger of cummulative effects.;
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|