ChemNet > CAS > 7206-70-4 4-Amino-5-chloro-2-methoxybenzoic acid
7206-70-4 4-Amino-5-chloro-2-methoxybenzoic acid
उत्पाद का नाम |
4-Amino-5-chloro-2-methoxybenzoic acid |
अंग्रेजी नाम |
4-Amino-5-chloro-2-methoxybenzoic acid;4-amino-5-chloro-2-methoxybenzoate |
आणविक फार्मूला |
C8H7ClNO3 |
आण्विक वजन |
200.5996 |
InChI |
InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12)/p-1 |
कैस रजिस्टी संख्या |
7206-70-4 |
EINECS |
230-582-3 |
आणविक संरचना |
|
गलनांक |
206-210℃ |
उबलने का समय |
369.7°C at 760 mmHg |
फ्लैश प्वाइंट |
177.4°C |
वाष्प का दबाव |
4.06E-06mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R22:Harmful if swallowed.;
|
सुरक्षा विवरण |
S28B:After contact with skin, wash immediately with plenty of water and soap.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
|
|