ChemNet > CAS > 74470-23-8 2-(Methylthio)nicotinic acid
74470-23-8 2-(Methylthio)nicotinic acid
| उत्पाद का नाम |
2-(Methylthio)nicotinic acid |
| अंग्रेजी नाम |
2-(Methylthio)nicotinic acid; 2-(Methylmercapto)pyridine-3-carboxylic acid~2-(Methylthio)pyridine-3-carboxylic acid; 2-(Methylmercapto)-nicotinic acid; 2-(methylsulfanyl)pyridine-3-carboxylic acid; 2-(methylsulfanyl)pyridine-3-carboxylate |
| आणविक फार्मूला |
C7H6NO2S |
| आण्विक वजन |
168.1936 |
| InChI |
InChI=1/C7H7NO2S/c1-11-6-5(7(9)10)3-2-4-8-6/h2-4H,1H3,(H,9,10)/p-1 |
| कैस रजिस्टी संख्या |
74470-23-8 |
| आणविक संरचना |
|
| गलनांक |
214-218℃ |
| उबलने का समय |
329.6°C at 760 mmHg |
| फ्लैश प्वाइंट |
153.2°C |
| वाष्प का दबाव |
7.04E-05mmHg at 25°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
