ChemNet > CAS > 761-02-4 triethylammonium sulphamate
761-02-4 triethylammonium sulphamate
उत्पाद का नाम |
triethylammonium sulphamate |
अंग्रेजी नाम |
triethylammonium sulphamate;Sulfamic acid, compd. with N,N-diethylethanamine (1:1); Sulfamic acid, compd. with triethylamine (1:1); Triethylamine sulfamate; Triethylammonium sulphamate; sulfamic acid - N,N-diethylethanamine (1:1) |
आणविक फार्मूला |
C6H18N2O3S |
आण्विक वजन |
198.2837 |
InChI |
InChI=1/C6H15N.H3NO3S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H3,1,2,3,4) |
कैस रजिस्टी संख्या |
761-02-4 |
EINECS |
212-087-4 |
आणविक संरचना |
|
उबलने का समय |
90.5°C at 760 mmHg |
फ्लैश प्वाइंट |
152.2°C |
वाष्प का दबाव |
56.1mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
|
|