ChemNet > CAS > 76989-89-4 Cyanourea, sodium salt
76989-89-4 Cyanourea, sodium salt
उत्पाद का नाम |
Cyanourea, sodium salt |
अंग्रेजी नाम |
Cyanourea, sodium salt; Cyanourea sodium salt; Cyanoisourea sodium salt; 1-cyanourea; sodium N'-cyanoimidocarbamate |
आणविक फार्मूला |
C2H2N3NaO |
आण्विक वजन |
107.0465 |
InChI |
InChI=1/C2H3N3O.Na/c3-1-5-2(4)6;/h(H3,4,5,6);/q;+1/p-1 |
कैस रजिस्टी संख्या |
76989-89-4 |
EINECS |
278-584-3 |
आणविक संरचना |
|
गलनांक |
300℃ |
उबलने का समय |
263.3°C at 760 mmHg |
फ्लैश प्वाइंट |
113.1°C |
वाष्प का दबाव |
0.00146mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|