771-97-1 2,3-Diaminonaphthalene
उत्पाद का नाम |
2,3-Diaminonaphthalene |
अंग्रेजी नाम |
2,3-Diaminonaphthalene; 2,3-Naphthalenediamine; naphthalene-2,3-diamine |
आणविक फार्मूला |
C10H10N2 |
आण्विक वजन |
158.1998 |
InChI |
InChI=1/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
कैस रजिस्टी संख्या |
771-97-1 |
EINECS |
212-241-0 |
आणविक संरचना |
|
घनत्व |
1.234g/cm3 |
गलनांक |
193-199℃ |
उबलने का समय |
370.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.757 |
फ्लैश प्वाइंट |
212.3°C |
वाष्प का दबाव |
1.1E-05mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|