ChemNet > CAS > 7756-94-7 Triisobutylene (mixture of branched chain isomer)
7756-94-7 Triisobutylene (mixture of branched chain isomer)
| उत्पाद का नाम |
Triisobutylene (mixture of branched chain isomer) |
| अंग्रेजी नाम |
Triisobutylene (mixture of branched chain isomer); 1-Propene, 2-methyl-, trimer; Triisobutylene; Triisobutylene [UN2324] [Flammable liquid]; UN2324; tert-butyl |
| आणविक फार्मूला |
C4H9 |
| आण्विक वजन |
57.1143 |
| InChI |
InChI=1/C4H9/c1-4(2)3/h1-3H3 |
| कैस रजिस्टी संख्या |
7756-94-7 |
| आणविक संरचना |
|
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
|
|
