ChemNet > CAS > 80166-90-1 5-Bromo-7-nitroindoline
80166-90-1 5-Bromo-7-nitroindoline
| उत्पाद का नाम |
5-Bromo-7-nitroindoline |
| अंग्रेजी नाम |
5-Bromo-7-nitroindoline; 5-Bromo-7-Nitro-2,3-dihydro-1H-indole |
| आणविक फार्मूला |
C8H7BrN2O2 |
| आण्विक वजन |
243.0574 |
| InChI |
InChI=1/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 |
| कैस रजिस्टी संख्या |
80166-90-1 |
| EINECS |
279-411-4 |
| आणविक संरचना |
|
| घनत्व |
1.704g/cm3 |
| उबलने का समय |
344.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.64 |
| फ्लैश प्वाइंट |
162°C |
| वाष्प का दबाव |
6.67E-05mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
