ChemNet > CAS > 80333-65-9 3,3',4,4'-tetrachlorobiphenyl-ul-14C
80333-65-9 3,3',4,4'-tetrachlorobiphenyl-ul-14C
उत्पाद का नाम |
3,3',4,4'-tetrachlorobiphenyl-ul-14C |
अंग्रेजी नाम |
3,3',4,4'-tetrachlorobiphenyl-ul-14C;1,1'-Biphenyl, 3,3',4,4'-tetrachloro-, labeled with carbon-14; 3,3',4,4'-Tetrachloro(14C-U)biphenyl; 3,3',4,4'-Tetrachloro-1,1'-biphenyl labeled with carbon-14; 3,3',4,4'-tetrachlorobiphenyl |
आणविक फार्मूला |
C12H6Cl4 |
आण्विक वजन |
291.988 |
InChI |
InChI=1/C12H6Cl4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H |
कैस रजिस्टी संख्या |
80333-65-9 |
आणविक संरचना |
|
घनत्व |
1.441g/cm3 |
उबलने का समय |
380.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.612 |
फ्लैश प्वाइंट |
188.4°C |
वाष्प का दबाव |
1.17E-05mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
|
|