ChemNet > CAS > 80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
| उत्पाद का नाम |
4-Methyl-3-nitrobenzeneboronic acid |
| अंग्रेजी नाम |
4-Methyl-3-nitrobenzeneboronic acid; 4-Methyl-3-nitrophenylboronic acid; 3-Nitro-p-tolylboronic acid; (4-methyl-3-nitrophenyl)boronic acid; 4-methyl-3-nitrophenylboronic acid; 3-Nitropheny-4-methylphenylboronic acid |
| आणविक फार्मूला |
C7H8BNO4 |
| आण्विक वजन |
180.9537 |
| InChI |
InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
| कैस रजिस्टी संख्या |
80500-27-2 |
| आणविक संरचना |
|
| घनत्व |
1.33g/cm3 |
| गलनांक |
265-270 °C(lit.) |
| उबलने का समय |
356.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.563 |
| फ्लैश प्वाइंट |
169.5°C |
| वाष्प का दबाव |
1.05E-05mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
