ChemNet > CAS > 80866-80-4 2-Chloro-5-nitrobenzyl alcohol
80866-80-4 2-Chloro-5-nitrobenzyl alcohol
| उत्पाद का नाम |
2-Chloro-5-nitrobenzyl alcohol |
| अंग्रेजी नाम |
2-Chloro-5-nitrobenzyl alcohol;(2-chloro-5-nitrophenyl)methanol |
| आणविक फार्मूला |
C7H6ClNO3 |
| आण्विक वजन |
187.5804 |
| InChI |
InChI=1/C7H6ClNO3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-3,10H,4H2 |
| कैस रजिस्टी संख्या |
80866-80-4 |
| EINECS |
279-584-6 |
| आणविक संरचना |
|
| घनत्व |
1.476g/cm3 |
| गलनांक |
74-79℃ |
| उबलने का समय |
344.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.611 |
| फ्लैश प्वाइंट |
161.9°C |
| वाष्प का दबाव |
2.56E-05mmHg at 25°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
