ChemNet > CAS > 81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
| उत्पाद का नाम |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo |
| अंग्रेजी नाम |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo; 5-(Dimethylaminomethyl)furfuryl alcohol hydrochloride; {5-[(dimethylamino)methyl]furan-2-yl}methanol hydrochloride |
| आणविक फार्मूला |
C8H14ClNO2 |
| आण्विक वजन |
191.6553 |
| InChI |
InChI=1/C8H13NO2.ClH/c1-9(2)5-7-3-4-8(6-10)11-7;/h3-4,10H,5-6H2,1-2H3;1H |
| कैस रजिस्टी संख्या |
81074-81-9 |
| EINECS |
279-686-0 |
| आणविक संरचना |
|
| गलनांक |
122-125℃ |
| उबलने का समय |
217.7°C at 760 mmHg |
| फ्लैश प्वाइंट |
85.5°C |
| वाष्प का दबाव |
0.0762mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
