ChemNet > CAS > 82-07-5 Xanthene-9-carboxylic acid
82-07-5 Xanthene-9-carboxylic acid
उत्पाद का नाम |
Xanthene-9-carboxylic acid |
अंग्रेजी नाम |
Xanthene-9-carboxylic acid; xanthoic acid; Methyl xanthene-9-carboxylate; 9-Xanthene carboxylic acid; Xomthene-9-carboxylic methylester acid; 9H-xanthene-9-carboxylic acid; 9H-xanthene-9-carboxylate |
आणविक फार्मूला |
C14H9O3 |
आण्विक वजन |
225.22 |
InChI |
InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16)/p-1 |
कैस रजिस्टी संख्या |
82-07-5 |
EINECS |
201-394-9 |
आणविक संरचना |
|
गलनांक |
221-225℃ |
उबलने का समय |
391.3°C at 760 mmHg |
फ्लैश प्वाइंट |
153.1°C |
वाष्प का दबाव |
7.99E-07mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|