ChemNet > CAS > 823-76-7 Cyclohexyl methyl ketone
823-76-7 Cyclohexyl methyl ketone
| उत्पाद का नाम |
Cyclohexyl methyl ketone |
| अंग्रेजी नाम |
Cyclohexyl methyl ketone; Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone; Acetylcyclohexane; 1-cyclohexylethanone; 1-CYCLOHEXYLETHAN-1-ONE |
| आणविक फार्मूला |
C8H14O |
| आण्विक वजन |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
| कैस रजिस्टी संख्या |
823-76-7 |
| EINECS |
212-517-0 |
| आणविक संरचना |
|
| घनत्व |
0.916g/cm3 |
| उबलने का समय |
181.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.448 |
| फ्लैश प्वाइंट |
61.4°C |
| वाष्प का दबाव |
0.849mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
