ChemNet > CAS > 82366-55-0 4-Dimethylamino-3,5-dinitrobenzoic acid
82366-55-0 4-Dimethylamino-3,5-dinitrobenzoic acid
उत्पाद का नाम |
4-Dimethylamino-3,5-dinitrobenzoic acid |
अंग्रेजी नाम |
4-Dimethylamino-3,5-dinitrobenzoic acid;4-(dimethylamino)-3,5-dinitrobenzoate |
आणविक फार्मूला |
C9H8N3O6 |
आण्विक वजन |
254.1769 |
InChI |
InChI=1/C9H9N3O6/c1-10(2)8-6(11(15)16)3-5(9(13)14)4-7(8)12(17)18/h3-4H,1-2H3,(H,13,14)/p-1 |
कैस रजिस्टी संख्या |
82366-55-0 |
आणविक संरचना |
|
उबलने का समय |
424.7°C at 760 mmHg |
फ्लैश प्वाइंट |
210.6°C |
वाष्प का दबाव |
5.71E-08mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|