ChemNet > CAS > 83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
| उत्पाद का नाम |
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
| अंग्रेजी नाम |
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde;1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-; NSC 68230; 2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde; Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde; 2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
| आणविक फार्मूला |
C13H19NO |
| आण्विक वजन |
205.2961 |
| InChI |
InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
| कैस रजिस्टी संख्या |
83-18-1 |
| EINECS |
201-458-6 |
| आणविक संरचना |
|
| घनत्व |
1.07g/cm3 |
| उबलने का समय |
345.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.559 |
| फ्लैश प्वाइंट |
163°C |
| वाष्प का दबाव |
6E-05mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
