ChemNet > CAS > 83463-62-1 Bromochloroacetonitrile
83463-62-1 Bromochloroacetonitrile
| उत्पाद का नाम |
Bromochloroacetonitrile |
| अंग्रेजी नाम |
Bromochloroacetonitrile;Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
| आणविक फार्मूला |
C2HBrClN |
| आण्विक वजन |
154.393 |
| InChI |
InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
| कैस रजिस्टी संख्या |
83463-62-1 |
| आणविक संरचना |
|
| घनत्व |
1.932g/cm3 |
| उबलने का समय |
121.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.506 |
| फ्लैश प्वाइंट |
27.1°C |
| वाष्प का दबाव |
14.8mmHg at 25°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
