86-26-0 2-Methoxybiphenyl
उत्पाद का नाम |
2-Methoxybiphenyl |
अंग्रेजी नाम |
2-Methoxybiphenyl; 2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
आणविक फार्मूला |
C13H12O |
आण्विक वजन |
184.2338 |
InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
कैस रजिस्टी संख्या |
86-26-0 |
EINECS |
201-659-9 |
आणविक संरचना |
|
घनत्व |
1.03g/cm3 |
गलनांक |
30-33℃ |
उबलने का समय |
274°C at 760 mmHg |
अपवर्तक सूचकांक |
1.556 |
फ्लैश प्वाइंट |
101.3°C |
वाष्प का दबाव |
0.00928mmHg at 25°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R33:Danger of cummulative effects.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|