ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
उत्पाद का नाम |
poly(chlorotrifluoroethylene) |
अंग्रेजी नाम |
poly(chlorotrifluoroethylene); halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
आणविक फार्मूला |
C2ClF3 |
आण्विक वजन |
116.4693 |
InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
कैस रजिस्टी संख्या |
9002-83-9 |
आणविक संरचना |
|
घनत्व |
1.9 |
गलनांक |
210℃ |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|