928-47-2 S-n-Butyl thioacetate
उत्पाद का नाम |
S-n-Butyl thioacetate |
अंग्रेजी नाम |
S-n-Butyl thioacetate; Thioacetic acid S-n-butyl ester; S-butyl ethanethioate; S-butan-2-yl ethanethioate |
आणविक फार्मूला |
C6H12OS |
आण्विक वजन |
132.2239 |
InChI |
InChI=1/C6H12OS/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
कैस रजिस्टी संख्या |
928-47-2 |
आणविक संरचना |
|
घनत्व |
0.95g/cm3 |
उबलने का समय |
158.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.456 |
फ्लैश प्वाइंट |
44°C |
वाष्प का दबाव |
2.67mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
R10:Flammable.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|