ChemNet > CAS > 931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
931-17-9 1,2-Cyclohexanediol, mixture of cis and trans
| उत्पाद का नाम |
1,2-Cyclohexanediol, mixture of cis and trans |
| अंग्रेजी नाम |
1,2-Cyclohexanediol, mixture of cis and trans; 1,2-Cyclohexanediol, cis/trans-mix; 1,2-Cyclohexanediol; 1,2-Cyclohexandiol |
| आणविक फार्मूला |
C6H12O2 |
| आण्विक वजन |
116.16 |
| InChI |
InChI=1/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
| कैस रजिस्टी संख्या |
931-17-9 |
| EINECS |
213-229-8 |
| आणविक संरचना |
|
| गलनांक |
73-77℃ |
| उबलने का समय |
118-120℃ (10 mmHg) |
| पानी की विलेयता |
soluble |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S23:;
S24/25:;
|
|
